The reaction involves the formation of various compounds in a stepwise manner:
Phosphorus PPP reacts with Oxygen OOO to form Phosphorus Pentoxide P2O5P2O5P2O5Phosphorus Pentoxide P2O5P2O5P2O5 undergoes a further reaction representedbyXrepresented by XrepresentedbyX to convert into Sodium Phosphate Na3PO4Na3PO4Na3PO4Sodium Phosphate Na3PO4Na3PO4Na3PO4 then reacts with Calcium ions CaCaCa to form Calcium Phosphate Ca3(PO4)2Ca3(PO4)2Ca3(PO4)2
The reaction involves the formation of various compounds in a stepwise manner:
Phosphorus PPP reacts with Oxygen OOO to form Phosphorus Pentoxide P2O5P2O5P2O5Phosphorus Pentoxide P2O5P2O5P2O5 undergoes a further reaction representedbyXrepresented by XrepresentedbyX to convert into Sodium Phosphate Na3PO4Na3PO4Na3PO4Sodium Phosphate Na3PO4Na3PO4Na3PO4 then reacts with Calcium ions CaCaCa to form Calcium Phosphate Ca3(PO4)2Ca3(PO4)2Ca3(PO4)2