1 Мая 2019 в 19:43
189 +1
0
Ответы
1

The reaction involves the formation of various compounds in a stepwise manner:

Phosphorus PPP reacts with Oxygen OOO to form Phosphorus Pentoxide P2O5P2O5P2O5Phosphorus Pentoxide P2O5P2O5P2O5 undergoes a further reaction representedbyXrepresented by XrepresentedbyX to convert into Sodium Phosphate Na3PO4Na3PO4Na3PO4Sodium Phosphate Na3PO4Na3PO4Na3PO4 then reacts with Calcium ions CaCaCa to form Calcium Phosphate Ca3(PO4)2Ca3(PO4)2Ca3(PO4)2
28 Мая 2024 в 17:05
Не можешь разобраться в этой теме?
Обратись за помощью к экспертам
Гарантированные бесплатные доработки в течение 1 года
Быстрое выполнение от 2 часов
Проверка работы на плагиат
Поможем написать учебную работу
Прямой эфир