In this series of reactions, sodium bicarbonate NaHCO3NaHCO3NaHCO3 initially decomposes into carbon dioxide CO2CO2CO2 and an intermediate compound called calcium carbonate CaCO3CaCO3CaCO3. The calcium carbonate further reacts to form calcium bicarbonate Ca(HCO3)2Ca(HCO3)2Ca(HCO3)2, which eventually decomposes back into calcium carbonate and carbon dioxide in a reversible reaction.
In this series of reactions, sodium bicarbonate NaHCO3NaHCO3NaHCO3 initially decomposes into carbon dioxide CO2CO2CO2 and an intermediate compound called calcium carbonate CaCO3CaCO3CaCO3. The calcium carbonate further reacts to form calcium bicarbonate Ca(HCO3)2Ca(HCO3)2Ca(HCO3)2, which eventually decomposes back into calcium carbonate and carbon dioxide in a reversible reaction.